ChemNet > CAS > 163620-24-4 N- [5- (Trifluoromethyl) پیرید-2-yl] -N-متیل هیدرازین؛ Trifluoromethylpyridylmethylhydrazine2؛ 1-متیل-1- [5- (trifluoromethyl) -2-پیریدیل] هیدرازین؛ N- (7-کلروکینولین-4-ایل) اتان-1.2-دیامین؛ 1- (5- (trifluoromethyl) پیریدین-2-ایل) هیدرازین؛
163620-24-4 N- [5- (Trifluoromethyl) پیرید-2-yl] -N-متیل هیدرازین؛ Trifluoromethylpyridylmethylhydrazine2؛ 1-متیل-1- [5- (trifluoromethyl) -2-پیریدیل] هیدرازین؛ N- (7-کلروکینولین-4-ایل) اتان-1.2-دیامین؛ 1- (5- (trifluoromethyl) پیریدین-2-ایل) هیدرازین؛
| نام محصول |
N- [5- (Trifluoromethyl) پیرید-2-yl] -N-متیل هیدرازین؛ Trifluoromethylpyridylmethylhydrazine2؛ 1-متیل-1- [5- (trifluoromethyl) -2-پیریدیل] هیدرازین؛ N- (7-کلروکینولین-4-ایل) اتان-1.2-دیامین؛ 1- (5- (trifluoromethyl) پیریدین-2-ایل) هیدرازین؛ |
| نام انگلیسی |
N-[5-(Trifluoromethyl)pyrid-2-yl]-N-methyl hydrazine; Trifluoromethylpyridylmethylhydrazine2; 1-Methyl-1-[5-(trifluoromethyl)-2-pyridyl]hydrazine; N-(7-chloroquinolin-4-yl)ethane-1,2-diamine; 1-(5-(trifluoromethyl)pyridin-2-yl)hydrazine |
| میدان مغناطیسی |
C11H12ClN3 |
| وزن مولکولی |
221.6861 |
| InChI |
InChI=1/C11H12ClN3/c12-8-1-2-9-10(15-6-4-13)3-5-14-11(9)7-8/h1-3,5,7H,4,6,13H2,(H,14,15) |
| شماره سیایاس |
163620-24-4 |
| ساختار مولکولی |
|
| تراکم |
1.316g/cm3 |
| نقطه ذوب |
52-55℃ |
| نقطه غلیان |
415°C at 760 mmHg |
| ضریب شکست |
1.697 |
| نقطه اشتعال |
204.8°C |
| فشار بخار |
4.26E-07mmHg at 25°C |
| خطر نمادها |
Xn:Harmful;
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|